CymitQuimica logo

CAS 13152-85-7

:

2,2-dichloroacenaphthylen-1(2H)-one

Description:
2,2-Dichloroacenaphthylen-1(2H)-one, with the CAS number 13152-85-7, is an organic compound characterized by its acenaphthylene structure, which consists of a fused bicyclic aromatic system. This compound features two chlorine atoms substituted at the 2-position of the acenaphthylene moiety and a ketone functional group at the 1-position. It is typically a solid at room temperature and may exhibit a range of physical properties such as melting and boiling points that are influenced by its molecular structure and substituents. The presence of chlorine atoms contributes to its reactivity and potential applications in organic synthesis and materials science. Additionally, the compound may exhibit fluorescence properties, making it of interest in various chemical and photophysical studies. Safety data should be consulted for handling and exposure risks, as halogenated compounds can pose environmental and health hazards. Overall, 2,2-dichloroacenaphthylen-1(2H)-one is a notable compound in the field of organic chemistry with potential applications in research and industry.
Formula:C12H6Cl2O
InChI:InChI=1/C12H6Cl2O/c13-12(14)9-6-2-4-7-3-1-5-8(10(7)9)11(12)15/h1-6H
SMILES:c1cc2cccc3c2c(c1)C(=O)C3(Cl)Cl
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.