
CAS 13152-89-1
:1,2,3,4-Tetrahydrophthalazine
Description:
1,2,3,4-Tetrahydrophthalazine is a bicyclic organic compound characterized by its unique structure, which consists of a phthalazine framework with four hydrogen atoms added, resulting in a saturated form. This compound is typically colorless to pale yellow and may exhibit a slight aromatic odor. It is soluble in organic solvents, such as ethanol and ether, but has limited solubility in water. The molecular formula of 1,2,3,4-Tetrahydrophthalazine is C8H10N2, indicating the presence of two nitrogen atoms within its structure, which contributes to its chemical reactivity and potential applications. This compound is of interest in various fields, including medicinal chemistry, where it may serve as a precursor or intermediate in the synthesis of pharmaceuticals. Additionally, its derivatives may exhibit biological activity, making it a subject of research in drug development. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.
Formula:C8H10N2
InChI:InChI=1S/C8H10N2/c1-2-4-8-6-10-9-5-7(8)3-1/h1-4,9-10H,5-6H2
InChI key:InChIKey=STIWEDICJHIFJT-UHFFFAOYSA-N
SMILES:C1=2C(CNNC1)=CC=CC2
Synonyms:- 1,2,3,4-Tetrahydrophthalazine
- Phthalazine, 1,2,3,4-tetrahydro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
