
CAS 13152-95-9
:(2,4-Dimethylphenyl)(3-methylphenyl)methanone
Description:
(2,4-Dimethylphenyl)(3-methylphenyl)methanone, also known by its CAS number 13152-95-9, is an organic compound characterized by its ketone functional group, which is central to its structure. This compound features a methanone moiety bonded to two aromatic rings: one being a 2,4-dimethylphenyl group and the other a 3-methylphenyl group. The presence of multiple methyl substituents on the phenyl rings contributes to its hydrophobic nature and influences its physical properties, such as melting and boiling points. The compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its aromatic structure suggests potential applications in organic synthesis and materials science, particularly in the development of dyes or pharmaceuticals. Additionally, the presence of multiple methyl groups can enhance its stability and reactivity in various chemical reactions. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken.
Formula:C16H16O
InChI:InChI=1S/C16H16O/c1-11-5-4-6-14(10-11)16(17)15-8-7-12(2)9-13(15)3/h4-10H,1-3H3
InChI key:InChIKey=COCNAUUGIBCANE-UHFFFAOYSA-N
SMILES:C(=O)(C1=C(C)C=C(C)C=C1)C2=CC(C)=CC=C2
Synonyms:- Benzophenone, 2,3′,4-trimethyl-
- Methanone, (2,4-dimethylphenyl)(3-methylphenyl)-
- 2,3′,4-Trimethylbenzophenone
- 2,4,3′-Trimethylbenzophenone
- (2,4-Dimethylphenyl)(3-methylphenyl)methanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
