CAS 131534-70-8

2,4,6-TRIMETHYLCINNAMALDEHYDE

Description:

2,4,6-Trimethylcinnamaldehyde is an organic compound characterized by its aromatic structure and aldehyde functional group. It features a cinnamaldehyde backbone with three methyl groups located at the 2, 4, and 6 positions of the aromatic ring. This compound is typically a colorless to pale yellow liquid with a sweet, floral, and slightly spicy aroma, making it valuable in the fragrance and flavor industries. Its molecular formula is C12H14O, and it exhibits moderate solubility in organic solvents while being less soluble in water. The compound is known for its potential applications in perfumery, as well as in food flavoring, due to its pleasant scent profile. Additionally, it may possess antimicrobial properties, which could be explored for various applications. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards. Overall, 2,4,6-trimethylcinnamaldehyde is a versatile compound with significant industrial relevance.

Formula: C₁₂H₁₄O

InChI: InChI=1/C12H14O/c1-9-7-10(2)12(5-4-6-13)11(3)8-9/h4-8H,1-3H3/b5-4+

Synonyms:

• (2E)-3-(2,4,6-trimethylphenyl)prop-2-enal
• 2,4,6-Trimethylcinnamaldehyde

(2E)-3-(2,4,6-trimethylphenyl)prop-2-enal

CAS: 131534-70-8

Formula: C₁₂H₁₄O

Molecular weight: 174.2390

Ref: IN-DA000ZDL

(2E)-3-(2,4,6-Trimethylphenyl)prop-2-enal

CAS: 131534-70-8

Versatile small molecule scaffold

Formula: C₁₂H₁₄O

Purity: Min. 95%

Molecular weight: 174.24 g/mol

Ref: 3D-GFA53470