CymitQuimica logo

CAS 1315340-56-7

:

B-(4-Bromo-2-ethoxy-6-fluorophenyl)boronic acid

Description:
B-(4-Bromo-2-ethoxy-6-fluorophenyl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols, making it useful in various chemical reactions, particularly in Suzuki coupling reactions. The compound features a phenyl ring substituted with a bromine atom, an ethoxy group, and a fluorine atom, contributing to its unique reactivity and solubility properties. The presence of the boronic acid moiety allows it to participate in cross-coupling reactions, which are essential in the synthesis of complex organic molecules, including pharmaceuticals and agrochemicals. Additionally, the ethoxy group enhances its solubility in organic solvents, while the halogen substituents can influence the electronic properties of the molecule, affecting its reactivity. Overall, this compound is valuable in synthetic organic chemistry and materials science due to its versatile reactivity and functional group compatibility.
Formula:C8H9BBrFO3
InChI:InChI=1S/C8H9BBrFO3/c1-2-14-7-4-5(10)3-6(11)8(7)9(12)13/h3-4,12-13H,2H2,1H3
InChI key:InChIKey=QIAHCZUMIHBXQO-UHFFFAOYSA-N
SMILES:B(O)(O)C1=C(OCC)C=C(Br)C=C1F
Synonyms:
  • Boronic acid, B-(4-bromo-2-ethoxy-6-fluorophenyl)-
  • B-(4-Bromo-2-ethoxy-6-fluorophenyl)boronic acid
Found 4 products.