CAS 1315344-85-4

2-[5-(2-Chlorophenyl)-2-furanyl]cyclopropanamine

Description:

2-[5-(2-Chlorophenyl)-2-furanyl]cyclopropanamine is a chemical compound characterized by its unique structural features, which include a cyclopropanamine core and a substituted furanyl group. The presence of a 2-chlorophenyl moiety contributes to its potential biological activity, as halogenated aromatic compounds often exhibit significant interactions with biological targets. The cyclopropanamine structure may impart specific steric and electronic properties, influencing the compound's reactivity and interaction with enzymes or receptors. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its potential for modulating biological pathways. Additionally, the furan ring can enhance lipophilicity, affecting the compound's pharmacokinetics. As with many organic compounds, the solubility, stability, and reactivity of 2-[5-(2-Chlorophenyl)-2-furanyl]cyclopropanamine will depend on environmental conditions such as pH and temperature. Safety and handling considerations are essential, as with any chemical substance, particularly those with potential biological activity. Further studies would be necessary to fully elucidate its properties and potential applications.

Formula: C₁₃H₁₂ClNO

InChI: InChI=1S/C13H12ClNO/c14-10-4-2-1-3-8(10)12-5-6-13(16-12)9-7-11(9)15/h1-6,9,11H,7,15H2

InChI key: InChIKey=LFXKIVCUJWZMJL-UHFFFAOYSA-N

SMILES: NC1C(C=2OC(=CC2)C3=C(Cl)C=CC=C3)C1

Synonyms:

• 2-[5-(2-Chlorophenyl)-2-furanyl]cyclopropanamine
• Cyclopropanamine, 2-[5-(2-chlorophenyl)-2-furanyl]-