CAS 1315350-14-1

4-Amino-5,8-difluoro-3-quinolinecarboxylic acid hydrazide

Description:

4-Amino-5,8-difluoro-3-quinolinecarboxylic acid hydrazide is a chemical compound characterized by its unique structure, which includes a quinoline ring system substituted with amino and difluoro groups, as well as a hydrazide functional group. This compound typically exhibits properties such as moderate solubility in polar solvents, which is common for hydrazides, and may display biological activity due to its quinoline core, known for its presence in various pharmaceuticals. The presence of fluorine atoms can enhance lipophilicity and influence the compound's reactivity and interaction with biological targets. Additionally, the amino group can participate in hydrogen bonding, potentially affecting the compound's pharmacokinetics and pharmacodynamics. As with many quinoline derivatives, this compound may be of interest in medicinal chemistry, particularly in the development of antimicrobial or antitumor agents. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.

Formula: C₁₀H₈F₂N₄O

InChI: InChI=1S/C10H8F2N4O/c11-5-1-2-6(12)9-7(5)8(13)4(3-15-9)10(17)16-14/h1-3H,14H2,(H2,13,15)(H,16,17)

InChI key: InChIKey=VBVKAYUVNSDCSS-UHFFFAOYSA-N

SMILES: NC=1C2=C(N=CC1C(NN)=O)C(F)=CC=C2F

Synonyms:

• 3-Quinolinecarboxylic acid, 4-amino-5,8-difluoro-, hydrazide
• 4-Amino-5,8-difluoro-3-quinolinecarboxylic acid hydrazide