
CAS 1315365-08-2
:3,4-Dihydro-3-(1-methylethyl)pyrido[2,3-b]pyrazin-2(1H)-one
Description:
3,4-Dihydro-3-(1-methylethyl)pyrido[2,3-b]pyrazin-2(1H)-one is a heterocyclic organic compound characterized by its complex bicyclic structure, which includes both pyridine and pyrazine rings. This compound features a dihydro configuration, indicating the presence of two hydrogen atoms that contribute to its saturation. The presence of a 1-methylethyl group (isopropyl group) enhances its hydrophobic characteristics, potentially influencing its solubility and reactivity. The functional group of a ketone (indicated by the "one" in its name) suggests that it may participate in various chemical reactions, such as nucleophilic attacks or condensation reactions. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its unique structural features could also lead to specific interactions with biological targets, warranting further investigation into its pharmacological properties. Overall, 3,4-Dihydro-3-(1-methylethyl)pyrido[2,3-b]pyrazin-2(1H)-one represents a fascinating subject for research in both synthetic and medicinal chemistry.
Formula:C10H13N3O
InChI:InChI=1S/C10H13N3O/c1-6(2)8-10(14)12-7-4-3-5-11-9(7)13-8/h3-6,8H,1-2H3,(H,11,13)(H,12,14)
InChI key:InChIKey=BHQXQWNKWRIDPE-UHFFFAOYSA-N
SMILES:C(C)(C)C1NC=2C(NC1=O)=CC=CN2
Synonyms:- Pyrido[2,3-b]pyrazin-2(1H)-one, 3,4-dihydro-3-(1-methylethyl)-
- 3,4-Dihydro-3-(1-methylethyl)pyrido[2,3-b]pyrazin-2(1H)-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.