CymitQuimica logo

CAS 1315365-25-3

:

3-Bromo-N,N-dimethyl-8-quinolinecarboxamide

Description:
3-Bromo-N,N-dimethyl-8-quinolinecarboxamide is a chemical compound characterized by its quinoline structure, which features a bromine atom at the 3-position and a dimethylamino group at the 8-position. This compound is part of a class of molecules known for their biological activity, particularly in medicinal chemistry. The presence of the bromine atom can enhance the compound's reactivity and influence its pharmacological properties. The dimethylamino group contributes to the compound's basicity and solubility in various solvents, making it suitable for various applications in research and development. Additionally, the carboxamide functional group is known for its ability to form hydrogen bonds, which can play a crucial role in the compound's interactions with biological targets. Overall, 3-Bromo-N,N-dimethyl-8-quinolinecarboxamide is of interest for its potential applications in drug discovery and development, particularly in the fields of cancer research and antimicrobial activity.
Formula:C12H11BrN2O
InChI:InChI=1S/C12H11BrN2O/c1-15(2)12(16)10-5-3-4-8-6-9(13)7-14-11(8)10/h3-7H,1-2H3
InChI key:InChIKey=UEJMCZUVUZEESK-UHFFFAOYSA-N
SMILES:C(N(C)C)(=O)C=1C2=C(C=C(Br)C=N2)C=CC1
Synonyms:
  • 8-Quinolinecarboxamide, 3-bromo-N,N-dimethyl-
  • 3-Bromo-N,N-dimethyl-8-quinolinecarboxamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.