
CAS 1315365-27-5
:3-Ethyl-3,4-dihydropyrido[2,3-b]pyrazin-2(1H)-one
Description:
3-Ethyl-3,4-dihydropyrido[2,3-b]pyrazin-2(1H)-one is a heterocyclic organic compound characterized by its unique bicyclic structure, which incorporates both pyridine and pyrazine rings. This compound features an ethyl group at the 3-position of the dihydropyrido framework, contributing to its distinct chemical properties. The presence of the carbonyl group (ketone) at the 2-position enhances its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic additions and cycloadditions. The compound's molecular structure suggests it may exhibit interesting biological activities, which could be explored in medicinal chemistry. Additionally, its solubility and stability in different solvents can vary, influencing its applications in synthesis and formulation. As with many heterocycles, the electronic properties imparted by the nitrogen atoms in the rings can affect its interaction with biological targets, making it a subject of interest for drug discovery and development. Overall, 3-Ethyl-3,4-dihydropyrido[2,3-b]pyrazin-2(1H)-one represents a versatile scaffold in organic and medicinal chemistry.
Formula:C9H11N3O
InChI:InChI=1S/C9H11N3O/c1-2-6-9(13)12-7-4-3-5-10-8(7)11-6/h3-6H,2H2,1H3,(H,10,11)(H,12,13)
InChI key:InChIKey=VNVUICGDHURYSF-UHFFFAOYSA-N
SMILES:C(C)C1NC=2C(NC1=O)=CC=CN2
Synonyms:- 3-Ethyl-3,4-dihydropyrido[2,3-b]pyrazin-2(1H)-one
- Pyrido[2,3-b]pyrazin-2(1H)-one, 3-ethyl-3,4-dihydro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.