
CAS 1315365-32-2
:Piperidine, 3-(1H-imidazol-1-yl)-, hydrochloride (1:2)
Description:
Piperidine, 3-(1H-imidazol-1-yl)-, hydrochloride (1:2) is a chemical compound characterized by its piperidine and imidazole functional groups. It typically appears as a white to off-white crystalline solid and is soluble in water due to the presence of the hydrochloride salt form, which enhances its solubility compared to the free base. This compound is often studied for its potential biological activities, particularly in medicinal chemistry, where it may exhibit properties relevant to pharmacology. The presence of both the piperidine and imidazole rings suggests potential interactions with biological targets, making it of interest in drug development. Its hydrochloride form indicates that it is a salt, which can influence its stability, solubility, and bioavailability. As with many chemical substances, safety data should be consulted to understand its handling, toxicity, and environmental impact. Overall, Piperidine, 3-(1H-imidazol-1-yl)-, hydrochloride (1:2) represents a versatile structure in organic synthesis and pharmaceutical research.
Formula:C8H13N3·2ClH
InChI:InChI=1S/C8H13N3.2ClH/c1-2-8(6-9-3-1)11-5-4-10-7-11;;/h4-5,7-9H,1-3,6H2;2*1H
InChI key:InChIKey=YGHWDQLWEMNUAP-UHFFFAOYSA-N
SMILES:N1(C=CN=C1)C2CCCNC2.Cl
Synonyms:- Piperidine, 3-(1H-imidazol-1-yl)-, hydrochloride (1:2)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.