
CAS 1315365-33-3
:1,1-Dimethylethyl N-[2,3-dimethyl-1-(phenylmethyl)-4-piperidinyl]carbamate
Description:
1,1-Dimethylethyl N-[2,3-dimethyl-1-(phenylmethyl)-4-piperidinyl]carbamate, identified by its CAS number 1315365-33-3, is a chemical compound that belongs to the class of carbamates. This substance features a complex molecular structure characterized by a piperidine ring, which is a six-membered nitrogen-containing heterocycle, and a carbamate functional group. The presence of dimethyl and phenylmethyl substituents contributes to its unique properties, potentially influencing its solubility, reactivity, and biological activity. Typically, carbamates are known for their applications in pharmaceuticals, agrochemicals, and as intermediates in organic synthesis. The specific arrangement of substituents in this compound may impart distinct pharmacological effects, making it of interest in medicinal chemistry. Additionally, the steric hindrance introduced by the tert-butyl group can affect the compound's interaction with biological targets. As with many organic compounds, safety and handling precautions are essential due to potential toxicity or reactivity, and thorough characterization through techniques such as NMR and mass spectrometry is crucial for understanding its properties and applications.
Formula:C19H30N2O2
InChI:InChI=1S/C19H30N2O2/c1-14-15(2)21(13-16-9-7-6-8-10-16)12-11-17(14)20-18(22)23-19(3,4)5/h6-10,14-15,17H,11-13H2,1-5H3,(H,20,22)
InChI key:InChIKey=MIYNQZRSMKSJTR-UHFFFAOYSA-N
SMILES:C(N1C(C)C(C)C(NC(OC(C)(C)C)=O)CC1)C2=CC=CC=C2
Synonyms:- 1,1-Dimethylethyl N-[2,3-dimethyl-1-(phenylmethyl)-4-piperidinyl]carbamate
- Carbamic acid, N-[2,3-dimethyl-1-(phenylmethyl)-4-piperidinyl]-, 1,1-dimethylethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.