CAS 1315365-44-6

5-(3-Bromophenyl)-3-ethyl-1,2,4-oxadiazole

Description:

5-(3-Bromophenyl)-3-ethyl-1,2,4-oxadiazole is a heterocyclic organic compound characterized by the presence of an oxadiazole ring, which consists of two nitrogen atoms and three carbon atoms in its five-membered structure. The compound features a bromophenyl substituent at the 5-position and an ethyl group at the 3-position of the oxadiazole ring, contributing to its unique chemical properties. This structure imparts potential biological activity, making it of interest in medicinal chemistry and materials science. The presence of the bromine atom enhances the compound's reactivity and may influence its solubility and interaction with biological targets. Additionally, the oxadiazole moiety is known for its applications in pharmaceuticals, agrochemicals, and as a building block in organic synthesis. The compound's physical properties, such as melting point, boiling point, and solubility, would typically be determined through experimental methods, and its stability can be influenced by environmental factors. Overall, this compound represents a class of organic molecules with diverse applications in various fields of chemistry.

Formula: C₁₀H₉BrN₂O

InChI: InChI=1S/C10H9BrN2O/c1-2-9-12-10(14-13-9)7-4-3-5-8(11)6-7/h3-6H,2H2,1H3

InChI key: InChIKey=AIDNXYKVXYXSQJ-UHFFFAOYSA-N

SMILES: C(C)C=1N=C(ON1)C2=CC(Br)=CC=C2

Synonyms:

• 1,2,4-Oxadiazole, 5-(3-bromophenyl)-3-ethyl-
• 5-(3-Bromophenyl)-3-ethyl-1,2,4-oxadiazole