CAS 1315365-47-9

Cyclopentaneacetic acid, 1-(4-morpholinyl)-, ethyl ester, hydrochloride (1:1)

Description:

Cyclopentaneacetic acid, 1-(4-morpholinyl)-, ethyl ester, hydrochloride (1:1) is a chemical compound characterized by its unique structure, which includes a cyclopentane ring and a morpholine moiety. This compound typically exhibits properties associated with both carboxylic acids and esters, including potential solubility in polar solvents due to the presence of the morpholine group. The hydrochloride form indicates that it is a salt, which often enhances its stability and solubility in aqueous environments. The morpholine ring contributes to its potential biological activity, making it of interest in medicinal chemistry. The compound may exhibit moderate to high lipophilicity due to the cyclopentane and ethyl ester components, influencing its pharmacokinetic properties. Additionally, the presence of the hydrochloride suggests that it may be used in various applications, including pharmaceuticals, where controlled release and bioavailability are critical. Overall, this compound's characteristics make it a subject of interest for further research in both synthetic and medicinal chemistry contexts.

Formula: C₁₃H₂₃NO₃·ClH

InChI: InChI=1S/C13H23NO3.ClH/c1-2-17-12(15)11-13(5-3-4-6-13)14-7-9-16-10-8-14;/h2-11H2,1H3;1H

InChI key: InChIKey=VQIINUMZRARNJX-UHFFFAOYSA-N

SMILES: C(C(OCC)=O)C1(CCCC1)N2CCOCC2.Cl

Synonyms:

• Cyclopentaneacetic acid, 1-(4-morpholinyl)-, ethyl ester, hydrochloride (1:1)

Ethyl 2-[1-(morpholin-4-yl)cyclopentyl]acetate hydrochloride

CAS: 1315365-47-9

Versatile small molecule scaffold

Formula: C₁₃H₂₄ClNO₃

Purity: Min. 95%

Molecular weight: 277.79 g/mol

Ref: 3D-QCC36547