CAS 1315365-55-9

2-(4-Nitrophenyl)-5-oxazolemethanol

Description:

2-(4-Nitrophenyl)-5-oxazolemethanol is a chemical compound characterized by its oxazole ring structure, which is a five-membered heterocyclic compound containing both nitrogen and oxygen atoms. The presence of a nitrophenyl group indicates that there is a nitro substituent on a phenyl ring, which typically enhances the compound's reactivity and can influence its electronic properties. This compound may exhibit properties such as solubility in polar solvents due to the hydroxymethyl group, which can engage in hydrogen bonding. Additionally, the nitro group can impart significant polarity and may affect the compound's biological activity, making it of interest in medicinal chemistry. The oxazole moiety is known for its role in various biological activities, including antimicrobial and anti-inflammatory properties. Overall, 2-(4-Nitrophenyl)-5-oxazolemethanol is a compound of interest for further research in organic synthesis and potential pharmaceutical applications, although specific physical and chemical properties would need to be determined through experimental methods.

Formula: C₁₀H₈N₂O₄

InChI: InChI=1S/C10H8N2O4/c13-6-9-5-11-10(16-9)7-1-3-8(4-2-7)12(14)15/h1-5,13H,6H2

InChI key: InChIKey=FASWZHQOPDYKJG-UHFFFAOYSA-N

SMILES: C(O)C=1OC(=NC1)C2=CC=C(N(=O)=O)C=C2

Synonyms:

• 2-(4-Nitrophenyl)-5-oxazolemethanol
• 5-Oxazolemethanol, 2-(4-nitrophenyl)-

[2-(4-Nitrophenyl)-1,3-oxazol-5-yl]methanol

CAS: 1315365-55-9

[2-(4-Nitrophenyl)-1,3-oxazol-5-yl]methanol

Purity: 95%

Molecular weight: 220.18g/mol

Ref: 54-OR1052815

[2-(4-Nitrophenyl)-1,3-oxazol-5-yl]methanol

CAS: 1315365-55-9

Versatile small molecule scaffold

Formula: C₁₀H₈N₂O₄

Purity: Min. 95%

Molecular weight: 220.18 g/mol

Ref: 3D-QCC36555