CAS 1315365-78-6

3-Pyrrolidinamine, 1-(1-methyl-1H-pyrazol-3-yl)-

Description:

3-Pyrrolidinamine, 1-(1-methyl-1H-pyrazol-3-yl)- is an organic compound characterized by its unique structural features, which include a pyrrolidine ring and a pyrazole moiety. The presence of the pyrrolidine ring contributes to its potential as a building block in medicinal chemistry, often associated with various biological activities. The pyrazole group, particularly when substituted, can enhance the compound's pharmacological properties, making it of interest in drug development. This compound may exhibit properties such as solubility in polar solvents and potential interactions with biological targets due to its nitrogen-containing heterocycles. Its molecular structure suggests it could participate in hydrogen bonding, influencing its reactivity and interactions in biological systems. As with many nitrogen-containing compounds, it may also exhibit basicity, which can affect its behavior in different pH environments. Overall, 3-Pyrrolidinamine, 1-(1-methyl-1H-pyrazol-3-yl)- represents a class of compounds that are valuable in research and development within the fields of pharmaceuticals and organic synthesis.

Formula: C₈H₁₄N₄

InChI: InChI=1S/C8H14N4/c1-11-4-3-8(10-11)12-5-2-7(9)6-12/h3-4,7H,2,5-6,9H2,1H3

InChI key: InChIKey=HWMQIGXDBKSZNN-UHFFFAOYSA-N

SMILES: CN1N=C(C=C1)N2CC(N)CC2

Synonyms:

• 1-(1-Methyl-1H-pyrazol-3-yl)pyrrolidin-3-amine
• 3-Pyrrolidinamine, 1-(1-methyl-1H-pyrazol-3-yl)-

1-(1-Methyl-1H-pyrazol-3-yl)pyrrolidin-3-amine

CAS: 1315365-78-6

Versatile small molecule scaffold

Formula: C₈H₁₄N₄

Purity: Min. 95%

Molecular weight: 166.22 g/mol

Ref: 3D-QCC36578