
CAS 1315365-79-7
:2-(Ethylamino)-4-fluorobenzoic acid
Description:
2-(Ethylamino)-4-fluorobenzoic acid is an organic compound characterized by its aromatic structure, which includes a fluorine atom and an ethylamino group attached to a benzoic acid framework. The presence of the fluorine atom typically enhances the compound's lipophilicity and may influence its biological activity. The ethylamino group contributes to the compound's basicity and can participate in hydrogen bonding, affecting solubility and reactivity. As a benzoic acid derivative, it possesses a carboxylic acid functional group, which is known for its acidic properties. This compound may exhibit various pharmacological activities, making it of interest in medicinal chemistry. Its molecular structure allows for potential interactions with biological targets, which could be explored in drug development. Additionally, the compound's stability, solubility, and reactivity can be influenced by the substituents on the aromatic ring, making it a subject of study in both synthetic and applied chemistry contexts. Overall, 2-(Ethylamino)-4-fluorobenzoic acid represents a versatile chemical entity with potential applications in various fields.
Formula:C9H10FNO2
InChI:InChI=1S/C9H10FNO2/c1-2-11-8-5-6(10)3-4-7(8)9(12)13/h3-5,11H,2H2,1H3,(H,12,13)
InChI key:InChIKey=KHVBWIXFUFGVCA-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(NCC)C=C(F)C=C1
Synonyms:- Benzoic acid, 2-(ethylamino)-4-fluoro-
- 2-(Ethylamino)-4-fluorobenzoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.