CymitQuimica logo

CAS 1315365-91-3

:

1,2,3,4-Tetrahydro-N-methyl-4-quinolinepropanamide

Description:
1,2,3,4-Tetrahydro-N-methyl-4-quinolinepropanamide is a chemical compound characterized by its unique structure, which includes a tetrahydroquinoline moiety and an amide functional group. This compound features a bicyclic structure that contributes to its potential biological activity, often associated with various pharmacological properties. The presence of the N-methyl group enhances its lipophilicity, potentially influencing its ability to cross biological membranes. As a member of the quinoline family, it may exhibit interactions with various biological targets, making it of interest in medicinal chemistry. The compound's solubility, stability, and reactivity can vary based on environmental conditions and the presence of other functional groups. Its CAS number, 1315365-91-3, allows for precise identification in chemical databases, facilitating research and development in fields such as drug discovery and organic synthesis. Overall, this compound's structural features suggest it may have applications in therapeutic contexts, although specific biological activities would require further investigation.
Formula:C13H18N2O
InChI:InChI=1S/C13H18N2O/c1-14-13(16)7-6-10-8-9-15-12-5-3-2-4-11(10)12/h2-5,10,15H,6-9H2,1H3,(H,14,16)
InChI key:InChIKey=RZGCEEZYQYVLMD-UHFFFAOYSA-N
SMILES:C(CC(NC)=O)C1C=2C(NCC1)=CC=CC2
Synonyms:
  • 4-Quinolinepropanamide, 1,2,3,4-tetrahydro-N-methyl-
  • 1,2,3,4-Tetrahydro-N-methyl-4-quinolinepropanamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.