CAS 1315366-10-9

4-Methyl-8-quinolinesulfonamide

Description:

4-Methyl-8-quinolinesulfonamide is a chemical compound characterized by its quinoline structure, which consists of a bicyclic aromatic system containing a nitrogen atom. This compound features a methyl group at the 4-position and a sulfonamide functional group, which contributes to its solubility and reactivity. The sulfonamide group is known for its biological activity, often exhibiting antibacterial properties. The presence of the quinoline moiety can also impart additional pharmacological effects, making this compound of interest in medicinal chemistry. Its molecular structure allows for potential interactions with biological targets, which can be explored for therapeutic applications. The compound is typically synthesized through specific organic reactions that introduce the sulfonamide and methyl groups onto the quinoline framework. As with many sulfonamides, it may exhibit properties such as moderate to high melting points and solubility in polar solvents, depending on the specific substituents and their arrangement. Overall, 4-Methyl-8-quinolinesulfonamide represents a class of compounds that are valuable in both research and potential pharmaceutical development.

Formula: C₁₀H₁₀N₂O₂S

InChI: InChI=1S/C10H10N2O2S/c1-7-5-6-12-10-8(7)3-2-4-9(10)15(11,13)14/h2-6H,1H3,(H2,11,13,14)

InChI key: InChIKey=ZAFJGWOBSVYACM-UHFFFAOYSA-N

SMILES: S(N)(=O)(=O)C=1C2=C(C(C)=CC=N2)C=CC1

Synonyms:

• 8-Quinolinesulfonamide, 4-methyl-
• 4-Methyl-8-quinolinesulfonamide

4-Methylquinoline-8-sulfonamide

CAS: 1315366-10-9

Versatile small molecule scaffold

Formula: C₁₀H₁₀N₂O₂S

Purity: Min. 95%

Molecular weight: 222.27 g/mol

Ref: 3D-QCC36610