CAS 1315366-21-2

1-[(5-Chloro-3-ethyl-1-methyl-1H-pyrazol-4-yl)methyl]piperazine

Description:

1-[(5-Chloro-3-ethyl-1-methyl-1H-pyrazol-4-yl)methyl]piperazine is a chemical compound characterized by its unique structure, which includes a piperazine ring and a pyrazole moiety. The presence of a chlorine atom and an ethyl group on the pyrazole contributes to its chemical reactivity and potential biological activity. This compound is typically classified as a heterocyclic organic compound due to the inclusion of nitrogen atoms in both the piperazine and pyrazole rings. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as compounds with similar frameworks often exhibit significant biological properties. The specific arrangement of substituents can influence its solubility, stability, and interaction with biological targets. Additionally, the compound's CAS number, 1315366-21-2, allows for precise identification and retrieval of information regarding its properties, safety data, and regulatory status in chemical databases. Overall, this compound represents a class of molecules that may be of interest for further research and development in various chemical and pharmaceutical applications.

Formula: C₁₁H₁₉ClN₄

InChI: InChI=1S/C11H19ClN4/c1-3-10-9(11(12)15(2)14-10)8-16-6-4-13-5-7-16/h13H,3-8H2,1-2H3

InChI key: InChIKey=ABIXOWLPIOOLAA-UHFFFAOYSA-N

SMILES: C(C=1C(CC)=NN(C)C1Cl)N2CCNCC2

Synonyms:

• 1-[(5-Chloro-3-ethyl-1-methyl-1H-pyrazol-4-yl)methyl]piperazine
• Piperazine, 1-[(5-chloro-3-ethyl-1-methyl-1H-pyrazol-4-yl)methyl]-

1-[(5-Chloro-3-ethyl-1-methyl-1H-pyrazol-4-yl)methyl]piperazine

Controlled Product

CAS: 1315366-21-2

Versatile small molecule scaffold

Formula: C₁₁H₁₉ClN₄

Purity: Min. 95%

Molecular weight: 242.75 g/mol

Ref: 3D-QCC36621