CAS 1315366-25-6

4-Penten-2-amine, hydrochloride (1:1)

Description:

4-Penten-2-amine, hydrochloride (1:1) is an organic compound characterized by its amine functional group and a double bond in its carbon chain. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form. This compound features a five-carbon chain with a double bond between the second and third carbon atoms, contributing to its reactivity and potential applications in organic synthesis. The presence of the amine group suggests that it can participate in various chemical reactions, such as nucleophilic substitutions and coupling reactions. Its hydrochloride form indicates that it can exist as a white crystalline solid, which is common for many amine hydrochlorides, enhancing its handling and storage properties. The compound may have applications in pharmaceuticals or as an intermediate in the synthesis of more complex molecules. However, specific safety and handling guidelines should be followed, as with any chemical substance, due to potential toxicity or reactivity.

Formula: C₅H₁₁N·ClH

InChI: InChI=1S/C5H11N.ClH/c1-3-4-5(2)6;/h3,5H,1,4,6H2,2H3;1H

InChI key: InChIKey=PBKZSPFYOORUPB-UHFFFAOYSA-N

SMILES: C(C(C)N)C=C.Cl

Synonyms:

• 4-Penten-2-amine, hydrochloride (1:1)

Pent-4-en-2-amine hydrochloride

CAS: 1315366-25-6

Pent-4-en-2-amine hydrochloride

Purity: 95%

Color and Shape: Solid

Molecular weight: 121.61g/mol

Ref: 54-OR55255