CAS 1315366-32-5: 1-[1-(1,1-Dimethylethyl)-3,5-dimethyl-1H-pyrazol-4-yl]-2,2,2-trifluoroethanone
Description:1-[1-(1,1-Dimethylethyl)-3,5-dimethyl-1H-pyrazol-4-yl]-2,2,2-trifluoroethanone, identified by its CAS number 1315366-32-5, is a chemical compound characterized by its unique structural features, including a pyrazole ring and a trifluoroethanone moiety. The presence of the bulky tert-butyl group and additional methyl groups on the pyrazole ring contributes to its steric hindrance, which can influence its reactivity and interactions with other molecules. The trifluoroethanone group imparts significant polarity and can enhance the compound's solubility in polar solvents. This compound may exhibit interesting biological activities due to its structural complexity, making it a candidate for various applications in medicinal chemistry and agrochemicals. Its synthesis and characterization would typically involve standard organic chemistry techniques, and its stability and reactivity would be assessed under various conditions. Overall, this compound represents a class of pyrazole derivatives that may have potential utility in research and development.
Formula:C11H15F3N2O
InChI:InChI=1S/C11H15F3N2O/c1-6-8(9(17)11(12,13)14)7(2)16(15-6)10(3,4)5/h1-5H3
InChI key:InChIKey=IJRGGQPBKIMHOE-UHFFFAOYSA-N
SMILES:O=C(C=1C(=NN(C1C)C(C)(C)C)C)C(F)(F)F
- Synonyms:
- 1-[1-(1,1-Dimethylethyl)-3,5-dimethyl-1H-pyrazol-4-yl]-2,2,2-trifluoroethanone
- 1-(1-tert-Butyl-3,5-dimethyl-1H-pyrazol-4-yl)-2,2,2-trifluoroethan-1-one
- Ethanone, 1-[1-(1,1-dimethylethyl)-3,5-dimethyl-1H-pyrazol-4-yl]-2,2,2-trifluoro-
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 1-(1-tert-Butyl-3,5-dimethyl-1H-pyrazol-4-yl)-2,2,2-trifluoroethan-1-one REF: 3D-QCC36632CAS: 1315366-32-5 | Min. 95% | 188.00 €~1,689.00 € | Mon 19 May 25 |
![]() | 1-(1-Tert-butyl-3,5-dimethyl-1h-pyrazol-4-yl)-2,2,2-trifluoroethan-1-one REF: 10-F673294CAS: 1315366-32-5 | 95% | - - - | Discontinued product |

1-(1-tert-Butyl-3,5-dimethyl-1H-pyrazol-4-yl)-2,2,2-trifluoroethan-1-one
Ref: 3D-QCC36632
50mg | 478.00 € | ||
500mg | 1,310.00 € |

1-(1-Tert-butyl-3,5-dimethyl-1h-pyrazol-4-yl)-2,2,2-trifluoroethan-1-one
Ref: 10-F673294
1g | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |