CAS 1315366-65-4

1,2,3,4-Tetrahydro-N,N-dimethyl-4-quinolinepropanamide

Description:

1,2,3,4-Tetrahydro-N,N-dimethyl-4-quinolinepropanamide is a chemical compound characterized by its unique structure, which includes a quinoline ring fused with a saturated tetrahydro framework. This compound features a dimethylamino group, contributing to its potential as a pharmacological agent. The presence of the amide functional group suggests that it may exhibit properties typical of amides, such as hydrogen bonding capabilities, which can influence its solubility and reactivity. The compound's molecular structure indicates that it may have applications in medicinal chemistry, particularly in the development of drugs targeting various biological pathways. Its specific stereochemistry and functional groups may also play a crucial role in its biological activity and interaction with receptors or enzymes. As with many organic compounds, the physical properties such as melting point, boiling point, and solubility would depend on the specific conditions and purity of the substance. Further studies would be necessary to fully elucidate its characteristics and potential applications in various fields, including pharmaceuticals and materials science.

Formula: C₁₄H₂₀N₂O

InChI: InChI=1S/C14H20N2O/c1-16(2)14(17)8-7-11-9-10-15-13-6-4-3-5-12(11)13/h3-6,11,15H,7-10H2,1-2H3

InChI key: InChIKey=OSDXCIHLRWIEGJ-UHFFFAOYSA-N

SMILES: C(CC(N(C)C)=O)C1C=2C(NCC1)=CC=CC2

Synonyms:

• 1,2,3,4-Tetrahydro-N,N-dimethyl-4-quinolinepropanamide
• 4-Quinolinepropanamide, 1,2,3,4-tetrahydro-N,N-dimethyl-