CAS 1315367-26-0

1-[2-(Acetyloxy)ethyl]-1H-pyrazole-4-carboxaldehyde

Description:

1-[2-(Acetyloxy)ethyl]-1H-pyrazole-4-carboxaldehyde is a chemical compound characterized by its pyrazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. This substance features an acetyloxy group, indicating the presence of an acetyl functional group linked through an ether bond, contributing to its reactivity and potential applications in organic synthesis. The aldehyde functional group at the 4-position of the pyrazole ring is notable for its ability to undergo various chemical reactions, such as oxidation and condensation, making it a versatile intermediate in the synthesis of more complex molecules. The compound's structure suggests potential biological activity, which may be explored in medicinal chemistry. Additionally, its solubility and stability in various solvents can influence its application in research and industry. Overall, this compound represents a unique combination of functional groups that may offer interesting properties for further study in chemical and pharmaceutical contexts.

Formula: C₈H₁₀N₂O₃

InChI: InChI=1S/C8H10N2O3/c1-7(12)13-3-2-10-5-8(6-11)4-9-10/h4-6H,2-3H2,1H3

InChI key: InChIKey=GJNWFGFRZMKZAQ-UHFFFAOYSA-N

SMILES: C(COC(C)=O)N1C=C(C=O)C=N1

Synonyms:

• 1-[2-(Acetyloxy)ethyl]-1H-pyrazole-4-carboxaldehyde
• 1H-Pyrazole-4-carboxaldehyde, 1-[2-(acetyloxy)ethyl]-
• 2-(4-Formyl-1H-pyrazol-1-yl)ethyl acetate

2-(4-Formyl-1H-pyrazol-1-yl)ethyl acetate

CAS: 1315367-26-0

Versatile small molecule scaffold

Formula: C₈H₁₀N₂O₃

Purity: Min. 95%

Molecular weight: 182.18 g/mol

Ref: 3D-QCC36726