
CAS 1315367-60-2
:2,6-Dimethyl-1-(phenylmethyl)-3-piperidinone
Description:
2,6-Dimethyl-1-(phenylmethyl)-3-piperidinone, identified by its CAS number 1315367-60-2, is a chemical compound that belongs to the class of piperidinones. This substance features a piperidine ring, which is a six-membered ring containing one nitrogen atom, and is substituted at the 1-position with a phenylmethyl group and at the 2 and 6 positions with methyl groups. The presence of these substituents contributes to its unique chemical properties, including potential lipophilicity and the ability to engage in various chemical reactions. The compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its structural characteristics suggest it could interact with biological targets, potentially influencing pharmacological effects. As with many organic compounds, its solubility, stability, and reactivity can vary based on environmental conditions such as temperature and pH. Safety data and handling precautions should be consulted when working with this compound, as with any chemical substance.
Formula:C14H19NO
InChI:InChI=1S/C14H19NO/c1-11-8-9-14(16)12(2)15(11)10-13-6-4-3-5-7-13/h3-7,11-12H,8-10H2,1-2H3
InChI key:InChIKey=JUVFBCNKSXUBOK-UHFFFAOYSA-N
SMILES:C(N1C(C)C(=O)CCC1C)C2=CC=CC=C2
Synonyms:- 2,6-Dimethyl-1-(phenylmethyl)-3-piperidinone
- 3-Piperidinone, 2,6-dimethyl-1-(phenylmethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.