
CAS 1315367-63-5
:2-[(3-Bromobenzoyl)amino]ethanesulfonyl chloride
Description:
2-[(3-Bromobenzoyl)amino]ethanesulfonyl chloride is a chemical compound characterized by its sulfonyl chloride functional group, which is known for its reactivity, particularly in nucleophilic substitution reactions. This compound features a bromobenzoyl moiety, indicating the presence of a bromine atom on the benzene ring, which can influence its reactivity and solubility. The amino group attached to the ethane chain suggests potential for further functionalization, making it a versatile intermediate in organic synthesis. Typically, sulfonyl chlorides are used in the preparation of sulfonamides and other derivatives, and they can act as electrophiles in various chemical reactions. The presence of the bromine atom may also impart unique properties, such as increased lipophilicity or altered electronic characteristics, which can affect the compound's behavior in biological systems or its utility in medicinal chemistry. Overall, this compound is of interest in synthetic organic chemistry and may have applications in drug development or as a reagent in various chemical transformations.
Formula:C9H9BrClNO3S
InChI:InChI=1S/C9H9BrClNO3S/c10-8-3-1-2-7(6-8)9(13)12-4-5-16(11,14)15/h1-3,6H,4-5H2,(H,12,13)
InChI key:InChIKey=QOLAOWUZQSOGQA-UHFFFAOYSA-N
SMILES:C(NCCS(Cl)(=O)=O)(=O)C1=CC(Br)=CC=C1
Synonyms:- 2-[(3-Bromobenzoyl)amino]ethanesulfonyl chloride
- Ethanesulfonyl chloride, 2-[(3-bromobenzoyl)amino]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.