CymitQuimica logo

CAS 1315367-67-9

:

1-(1-Pyrrolidinyl)-3-(1,2,3,4-tetrahydro-4-quinolinyl)-1-propanone

Description:
1-(1-Pyrrolidinyl)-3-(1,2,3,4-tetrahydro-4-quinolinyl)-1-propanone, identified by its CAS number 1315367-67-9, is a chemical compound that features a complex structure incorporating both a pyrrolidine and a tetrahydroquinoline moiety. This compound is characterized by its ketone functional group, which contributes to its reactivity and potential applications in medicinal chemistry. The presence of the pyrrolidine ring suggests possible interactions with biological targets, making it of interest in pharmacological research. Additionally, the tetrahydroquinoline structure may impart unique properties, such as enhanced lipophilicity or specific binding affinities. The compound's molecular weight, solubility, and stability would depend on its specific structural features and substituents. As with many compounds in this class, it may exhibit interesting biological activities, warranting further investigation for potential therapeutic uses. Safety and handling considerations are essential, as with all chemical substances, particularly those with unknown toxicity profiles.
Formula:C16H22N2O
InChI:InChI=1S/C16H22N2O/c19-16(18-11-3-4-12-18)8-7-13-9-10-17-15-6-2-1-5-14(13)15/h1-2,5-6,13,17H,3-4,7-12H2
InChI key:InChIKey=PPYCMTYHILIXSN-UHFFFAOYSA-N
SMILES:C(CC(=O)N1CCCC1)C2C=3C(NCC2)=CC=CC3
Synonyms:
  • 1-Propanone, 1-(1-pyrrolidinyl)-3-(1,2,3,4-tetrahydro-4-quinolinyl)-
  • 1-(1-Pyrrolidinyl)-3-(1,2,3,4-tetrahydro-4-quinolinyl)-1-propanone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.