CAS 1315367-84-0

2,4,5-Trimethyl-1-(phenylmethyl)-3-piperidinamine

Description:

2,4,5-Trimethyl-1-(phenylmethyl)-3-piperidinamine is a chemical compound characterized by its piperidine structure, which includes a six-membered ring containing nitrogen. The presence of three methyl groups at the 2, 4, and 5 positions of the piperidine ring contributes to its steric and electronic properties, potentially influencing its reactivity and interactions with biological targets. The phenylmethyl group attached to the nitrogen atom enhances its lipophilicity, which may affect its solubility and permeability in biological systems. This compound may exhibit pharmacological activity, making it of interest in medicinal chemistry. Its specific characteristics, such as melting point, boiling point, and solubility, would depend on its molecular interactions and the environment in which it is studied. As with many amines, it may also participate in hydrogen bonding, influencing its behavior in various chemical contexts. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.

Formula: C₁₅H₂₄N₂

InChI: InChI=1S/C15H24N2/c1-11-9-17(13(3)15(16)12(11)2)10-14-7-5-4-6-8-14/h4-8,11-13,15H,9-10,16H2,1-3H3

InChI key: InChIKey=MCYADVOUXKSBRH-UHFFFAOYSA-N

SMILES: C(N1C(C)C(N)C(C)C(C)C1)C2=CC=CC=C2

Synonyms:

• 3-Piperidinamine, 2,4,5-trimethyl-1-(phenylmethyl)-
• 2,4,5-Trimethyl-1-(phenylmethyl)-3-piperidinamine