
CAS 1315367-94-2
:6-Fluoro[1,2,4]triazolo[1,5-a]pyridine-2-sulfonyl chloride
Description:
6-Fluoro[1,2,4]triazolo[1,5-a]pyridine-2-sulfonyl chloride is a chemical compound characterized by its unique triazole and pyridine ring structure, which contributes to its potential applications in medicinal chemistry and pharmaceuticals. The presence of a sulfonyl chloride functional group indicates that it can act as a sulfonating agent, making it useful in various chemical reactions, particularly in the synthesis of sulfonamides and other derivatives. The fluorine atom in the structure can enhance the compound's biological activity and lipophilicity, potentially influencing its pharmacokinetic properties. This compound is typically handled with care due to the reactivity of the sulfonyl chloride group, which can hydrolyze in the presence of moisture, releasing hydrochloric acid. As with many heterocyclic compounds, it may exhibit interesting biological activities, making it a subject of interest in drug discovery and development. Safety precautions should be observed when working with this compound, as it may pose health hazards if inhaled or contacted with skin.
Formula:C6H3ClFN3O2S
InChI:InChI=1S/C6H3ClFN3O2S/c7-14(12,13)6-9-5-2-1-4(8)3-11(5)10-6/h1-3H
InChI key:InChIKey=PNESZPMEJZWCFS-UHFFFAOYSA-N
SMILES:S(Cl)(=O)(=O)C=1N=C2N(N1)C=C(F)C=C2
Synonyms:- 6-Fluoro[1,2,4]triazolo[1,5-a]pyridine-2-sulfonyl chloride
- [1,2,4]Triazolo[1,5-a]pyridine-2-sulfonyl chloride, 6-fluoro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.