CAS 1315368-09-2

N-(Cyanocyclopropylmethyl)benzamide

Description:

N-(Cyanocyclopropylmethyl)benzamide is a chemical compound characterized by its unique structure, which includes a benzamide moiety linked to a cyanocyclopropylmethyl group. This compound features a benzene ring attached to an amide functional group, which contributes to its potential as a pharmacophore in medicinal chemistry. The presence of the cyanocyclopropyl group introduces a three-membered ring structure that can influence the compound's reactivity and biological activity. The cyanide functional group may impart specific electronic properties, enhancing its interaction with biological targets. Typically, compounds like this may exhibit a range of physical properties, including solubility in organic solvents and varying degrees of stability under different conditions. The compound's potential applications could span various fields, including pharmaceuticals, where it may serve as a lead compound for drug development. However, detailed studies on its biological activity, toxicity, and environmental impact would be necessary to fully understand its characteristics and potential uses.

Formula: C₁₂H₁₂N₂O

InChI: InChI=1S/C12H12N2O/c13-8-11(9-6-7-9)14-12(15)10-4-2-1-3-5-10/h1-5,9,11H,6-7H2,(H,14,15)

InChI key: InChIKey=HRRFWVYCMGWODL-UHFFFAOYSA-N

SMILES: C(NC(=O)C1=CC=CC=C1)(C#N)C2CC2

Synonyms:

• Benzamide, N-(cyanocyclopropylmethyl)-
• N-(Cyanocyclopropylmethyl)benzamide

N-[Cyano(cyclopropyl)methyl]benzamide

CAS: 1315368-09-2

Versatile small molecule scaffold

Formula: C₁₂H₁₂N₂O

Purity: Min. 95%

Molecular weight: 200.24 g/mol

Ref: 3D-QCC36809