CAS 1315368-21-8

Isoquinoline, 1,2,3,4-tetrahydro-4-(1H-pyrazol-1-yl)-, hydrochloride (1:1)

Description:

Isoquinoline, 1,2,3,4-tetrahydro-4-(1H-pyrazol-1-yl)-, hydrochloride (1:1) is a chemical compound characterized by its complex structure, which includes a tetrahydroisoquinoline core and a pyrazole moiety. This compound typically appears as a hydrochloride salt, indicating it is soluble in water and may exhibit different properties compared to its free base form. The presence of the pyrazole ring suggests potential biological activity, as pyrazoles are often associated with pharmacological effects. The compound's molecular structure contributes to its potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. Its characteristics include a specific melting point, solubility profile, and reactivity, which are influenced by the functional groups present. Additionally, the hydrochloride form enhances stability and bioavailability, making it suitable for various experimental and pharmaceutical applications. As with many organic compounds, safety data and handling precautions are essential due to potential toxicity or reactivity.

Formula: C₁₂H₁₃N₃·ClH

InChI: InChI=1S/C12H13N3.ClH/c1-2-5-11-10(4-1)8-13-9-12(11)15-7-3-6-14-15;/h1-7,12-13H,8-9H2;1H

InChI key: InChIKey=BNYZUMKHXIRSNT-UHFFFAOYSA-N

SMILES: C1(C=2C(CNC1)=CC=CC2)N3C=CC=N3.Cl

Synonyms:

• Isoquinoline, 1,2,3,4-tetrahydro-4-(1H-pyrazol-1-yl)-, hydrochloride (1:1)

4-(1H-Pyrazol-1-yl)-1,2,3,4-tetrahydroisoquinoline hydrochloride

CAS: 1315368-21-8

Versatile small molecule scaffold

Formula: C₁₂H₁₄ClN₃

Purity: Min. 95%

Molecular weight: 235.71 g/mol

Ref: 3D-QCC36821