CymitQuimica logo

CAS 1315368-41-2

:

1,1-Dimethylethyl N-[2,4-dimethyl-1-(phenylmethyl)-3-piperidinyl]carbamate

Description:
1,1-Dimethylethyl N-[2,4-dimethyl-1-(phenylmethyl)-3-piperidinyl]carbamate, identified by its CAS number 1315368-41-2, is a chemical compound that belongs to the class of carbamates. This substance features a complex structure characterized by a piperidine ring, which is a six-membered nitrogen-containing heterocycle, and a carbamate functional group, which is known for its applications in pharmaceuticals and agrochemicals. The presence of dimethyl groups and a phenylmethyl substituent contributes to its unique properties, potentially influencing its solubility, stability, and biological activity. The compound may exhibit specific interactions with biological targets, making it of interest in medicinal chemistry. Its synthesis and characterization would typically involve standard organic chemistry techniques, and its properties would be assessed through various analytical methods. As with many carbamates, it is essential to consider safety and handling protocols due to potential toxicity and environmental impact. Further research would be necessary to fully elucidate its applications and mechanisms of action.
Formula:C19H30N2O2
InChI:InChI=1S/C19H30N2O2/c1-14-11-12-21(13-16-9-7-6-8-10-16)15(2)17(14)20-18(22)23-19(3,4)5/h6-10,14-15,17H,11-13H2,1-5H3,(H,20,22)
InChI key:InChIKey=XMRUFXRESHLTCT-UHFFFAOYSA-N
SMILES:C(N1C(C)C(NC(OC(C)(C)C)=O)C(C)CC1)C2=CC=CC=C2
Synonyms:
  • 1,1-Dimethylethyl N-[2,4-dimethyl-1-(phenylmethyl)-3-piperidinyl]carbamate
  • Carbamic acid, N-[2,4-dimethyl-1-(phenylmethyl)-3-piperidinyl]-, 1,1-dimethylethyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.