
CAS 1315368-44-5
:2-Amino-N,N,α,4-tetramethyl-5-pyrimidinemethanamine
Description:
2-Amino-N,N,α,4-tetramethyl-5-pyrimidinemethanamine is a chemical compound characterized by its pyrimidine ring structure, which is a six-membered aromatic heterocycle containing nitrogen atoms. This compound features multiple methyl groups, contributing to its tetramethyl designation, which can influence its solubility and reactivity. The presence of amino groups indicates that it can participate in various chemical reactions, including nucleophilic substitutions and condensation reactions. Its structure suggests potential applications in pharmaceuticals or as a biochemical probe due to the functional groups that can interact with biological systems. The compound's CAS number, 1315368-44-5, allows for precise identification in chemical databases. As with many organic compounds, its physical properties such as melting point, boiling point, and solubility would depend on the specific molecular interactions and the environment in which it is studied. Safety data and handling precautions should be consulted, as with any chemical substance, to ensure proper laboratory practices.
Formula:C9H16N4
InChI:InChI=1S/C9H16N4/c1-6-8(7(2)13(3)4)5-11-9(10)12-6/h5,7H,1-4H3,(H2,10,11,12)
InChI key:InChIKey=YKMIQZJTOUTYKE-UHFFFAOYSA-N
SMILES:C(N(C)C)(C)C=1C(C)=NC(N)=NC1
Synonyms:- 5-Pyrimidinemethanamine, 2-amino-N,N,α,4-tetramethyl-
- 2-Amino-N,N,α,4-tetramethyl-5-pyrimidinemethanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.