CAS 1315368-75-2

3-(8-Fluoro-3-quinolinyl)-2-propyn-1-amine

Description:

3-(8-Fluoro-3-quinolinyl)-2-propyn-1-amine is a chemical compound characterized by its unique structure, which includes a quinoline ring substituted with a fluorine atom and an alkyne functional group. The presence of the fluorine atom enhances the compound's lipophilicity and may influence its biological activity. The propynyl amine moiety suggests potential reactivity and interactions with biological targets, making it of interest in medicinal chemistry. This compound may exhibit properties such as being a potential ligand or inhibitor in various biochemical pathways. Its molecular structure allows for potential applications in drug development, particularly in targeting diseases where quinoline derivatives have shown efficacy. Additionally, the compound's stability, solubility, and reactivity can be influenced by the electronic effects of the fluorine substituent and the overall molecular conformation. As with many synthetic organic compounds, safety and handling precautions are essential due to potential toxicity or reactivity. Further studies would be necessary to fully elucidate its pharmacological properties and potential applications.

Formula: C₁₂H₉FN₂

InChI: InChI=1S/C12H9FN2/c13-11-5-1-4-10-7-9(3-2-6-14)8-15-12(10)11/h1,4-5,7-8H,6,14H2

InChI key: InChIKey=AWNPLOVOJXIBDT-UHFFFAOYSA-N

SMILES: FC=1C2=C(C=C(C#CCN)C=N2)C=CC1

Synonyms:

• 2-Propyn-1-amine, 3-(8-fluoro-3-quinolinyl)-
• 3-(8-Fluoro-3-quinolinyl)-2-propyn-1-amine