CAS 1315369-04-0

4H-Pyrano[4,3-d]thiazol-2-amine, 6,7-dihydro-, hydrobromide (1:1)

Description:

4H-Pyrano[4,3-d]thiazol-2-amine, 6,7-dihydro-, hydrobromide (1:1) is a chemical compound characterized by its unique bicyclic structure that incorporates both a pyran and thiazole moiety. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to the presence of nitrogen and sulfur atoms in its structure. The hydrobromide salt form indicates that it is a protonated version of the base compound, which can enhance its solubility in polar solvents and may influence its pharmacokinetic properties. The compound may be of interest in medicinal chemistry, particularly for its potential applications in drug development, as many thiazole derivatives are known for their antimicrobial, anti-inflammatory, and anticancer activities. Its molecular interactions, stability, and reactivity can be influenced by the presence of the hydrobromide, making it a subject of interest for further research in both synthetic and medicinal chemistry contexts.

Formula: C₆H₈N₂OS·BrH

InChI: InChI=1S/C6H8N2OS.BrH/c7-6-8-4-1-2-9-3-5(4)10-6;/h1-3H2,(H2,7,8);1H

InChI key: InChIKey=XKGZSXDWEUDRLD-UHFFFAOYSA-N

SMILES: NC1=NC2=C(S1)COCC2.Br

Synonyms:

• 4H-Pyrano[4,3-d]thiazol-2-amine, 6,7-dihydro-, hydrobromide (1:1)

4H,6H,7H-Pyrano[4,3-d][1,3]thiazol-2-amine hydrobromide

CAS: 1315369-04-0

Versatile small molecule scaffold

Formula: C₆H₉BrN₂OS

Purity: Min. 95%

Molecular weight: 237.12 g/mol

Ref: 3D-QCC36904