CAS 1315377-66-2

3-(2,4-Difluorophenyl)-2-propen-1-amine

Description:

3-(2,4-Difluorophenyl)-2-propen-1-amine, identified by its CAS number 1315377-66-2, is an organic compound characterized by its propenamine structure, which features a double bond between the second and third carbon atoms of the chain. The presence of a 2,4-difluorophenyl group indicates that two fluorine atoms are substituted on the phenyl ring at the 2 and 4 positions, contributing to the compound's unique electronic and steric properties. This substitution can enhance the compound's lipophilicity and influence its reactivity, making it of interest in medicinal chemistry and material science. The amine functional group suggests potential basicity and reactivity with electrophiles, which can be exploited in various chemical reactions. Additionally, the compound may exhibit specific biological activities, making it a candidate for further research in pharmacology. Its stability, solubility, and interaction with biological systems would depend on the surrounding conditions, such as pH and solvent polarity. Overall, this compound represents a valuable structure for exploration in synthetic and applied chemistry.

Formula: C₉H₉F₂N

InChI: InChI=1S/C9H9F2N/c10-8-4-3-7(2-1-5-12)9(11)6-8/h1-4,6H,5,12H2

InChI key: InChIKey=CURQSJPQMYDLSW-UHFFFAOYSA-N

SMILES: C(=CCN)C1=C(F)C=C(F)C=C1

Synonyms:

• 3-(2,4-Difluorophenyl)-2-propen-1-amine
• 2-Propen-1-amine, 3-(2,4-difluorophenyl)-