CAS 1315378-59-6

(αR)-α-Methyl-5-thiazolemethanamine

Description:

(αR)-α-Methyl-5-thiazolemethanamine, identified by its CAS number 1315378-59-6, is a chemical compound characterized by its thiazole ring structure, which contributes to its unique properties. This compound features a methyl group and an amine functional group, indicating potential basicity and reactivity. Thiazoles are known for their biological activity, often serving as building blocks in pharmaceuticals and agrochemicals. The specific stereochemistry denoted by (αR) suggests that the compound has a particular spatial arrangement, which can influence its interaction with biological targets. Typically, compounds like this may exhibit solubility in polar solvents and may participate in hydrogen bonding due to the presence of the amine group. Its potential applications could range from medicinal chemistry to materials science, depending on its reactivity and interaction with other chemical entities. As with many thiazole derivatives, it may also exhibit antimicrobial or antifungal properties, making it of interest in various research fields.

Formula: C₅H₈N₂S

InChI: InChI=1S/C5H8N2S/c1-4(6)5-2-7-3-8-5/h2-4H,6H2,1H3/t4-/m1/s1

InChI key: InChIKey=RLPSARLYTKXVSE-SCSAIBSYSA-N

SMILES: [C@H](C)(N)C1=CN=CS1

Synonyms:

• (1R)-1-(1,3-Thiazol-5-yl)ethan-1-amine
• 5-Thiazolemethanamine, α-methyl-, (αR)-
• (αR)-α-Methyl-5-thiazolemethanamine