CAS 13156-01-9
:1-Cyclohexyl-3-azetidinol
Description:
1-Cyclohexyl-3-azetidinol is a chemical compound characterized by its azetidine ring structure, which is a four-membered saturated heterocycle containing one nitrogen atom. The presence of a cyclohexyl group enhances its hydrophobic properties, making it less soluble in polar solvents. This compound typically exhibits a moderate boiling point and melting point, indicative of its molecular weight and structure. Its functional groups suggest potential reactivity, particularly in nucleophilic substitution reactions due to the nitrogen atom's lone pair. Additionally, 1-Cyclohexyl-3-azetidinol may display interesting biological activities, which could be explored for pharmaceutical applications. The compound's stereochemistry can influence its interactions and efficacy in biological systems. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance. Overall, 1-Cyclohexyl-3-azetidinol represents a unique structure with potential applications in organic synthesis and medicinal chemistry.
Formula:C9H17NO
InChI:InChI=1S/C9H17NO/c11-9-6-10(7-9)8-4-2-1-3-5-8/h8-9,11H,1-7H2
InChI key:InChIKey=GPNSPIGRLLHVCN-UHFFFAOYSA-N
SMILES:OC1CN(C1)C2CCCCC2
Synonyms:- 1-Cyclohexylazetidin-3-Ol
- 3-Azetidinol, 1-cyclohexyl-
- N-Cyclohexyl-3-azetidinol
- NSC 150331
- 1-Cyclohexyl-3-azetidinol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.