CAS 13156-97-3

2-CHLORO-N-(2-PHENYLETHYL)PROPANAMIDE

Description:

2-Chloro-N-(2-phenylethyl)propanamide, with the CAS number 13156-97-3, is an organic compound characterized by its amide functional group and the presence of a chloro substituent. This compound features a propanamide backbone, where the nitrogen atom is substituted with a 2-phenylethyl group, contributing to its unique properties. The chloro group introduces additional reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. The presence of the phenyl group enhances its hydrophobic character, which may influence its solubility in organic solvents compared to water. This compound may exhibit biological activity, making it of interest in medicinal chemistry and pharmacology. Its structural features suggest potential applications in the synthesis of more complex molecules or as intermediates in organic synthesis. As with many chlorinated compounds, it is essential to handle it with care due to potential toxicity and environmental concerns. Overall, 2-chloro-N-(2-phenylethyl)propanamide represents a versatile compound with implications in both research and industrial applications.

Formula: C₁₁H₁₄ClNO

InChI: InChI=1/C11H14ClNO/c1-9(12)11(14)13-8-7-10-5-3-2-4-6-10/h2-6,9H,7-8H2,1H3,(H,13,14)

SMILES: CC(C(=NCCc1ccccc1)O)Cl

Synonyms:

• Propionamide, 2-chloro-N-phenethyl-
• 2-Chloro-N-phenethylpropionamide
• Brn 2838585

2-chloro-N-(2-phenylethyl)propanamide

CAS: 13156-97-3

Formula: C₁₁H₁₄ClNO

Molecular weight: 211.688

Ref: IN-DA000ZFC

2-Chloro-N-(2-phenylethyl)propanamide

CAS: 13156-97-3

2-Chloro-N-(2-phenylethyl)propanamide is an isoquinoline ring that has been synthesized and tested for its ability to inhibit the biosynthesis of ergosterol. It was found to be more effective than other known inhibitors, such as tetraethyl pyrophosphate, in inhibiting this compound. 2-Chloro-N-(2-phenylethyl)propanamide may be a potential drug candidate for the treatment of fungal diseases. The mechanism for inhibition is not yet known.

Formula: C₁₁H₁₄ClNO

Purity: Min. 95%

Molecular weight: 211.69 g/mol

Ref: 3D-NAA15697