CymitQuimica logo

CAS 1315605-26-5

:

4-Bromo-2,7-dihexylbenzo[lmn][3,8]phenanthroline-1,3,6,8(2H,7H)-tetrone

Description:
4-Bromo-2,7-dihexylbenzo[lmn][3,8]phenanthroline-1,3,6,8(2H,7H)-tetrone is a complex organic compound characterized by its polycyclic structure, which incorporates multiple aromatic rings and functional groups. The presence of bromine and hexyl substituents contributes to its unique chemical properties, including potential solubility in organic solvents and varying reactivity. This compound is likely to exhibit interesting electronic and optical properties due to its extended π-conjugation system, making it a candidate for applications in organic electronics, such as organic light-emitting diodes (OLEDs) or organic photovoltaics. The tetrone functional groups suggest that it may participate in various chemical reactions, including oxidation and coordination with metal ions. Additionally, the compound's structural features may influence its stability, melting point, and potential interactions with biological systems. Overall, 4-Bromo-2,7-dihexylbenzo[lmn][3,8]phenanthroline-1,3,6,8(2H,7H)-tetrone represents a fascinating subject for further research in materials science and organic chemistry.
Formula:C26H29BrN2O4
InChI:InChI=1S/C26H29BrN2O4/c1-3-5-7-9-13-28-23(30)16-11-12-17-21-20(16)18(25(28)32)15-19(27)22(21)26(33)29(24(17)31)14-10-8-6-4-2/h11-12,15H,3-10,13-14H2,1-2H3
InChI key:InChIKey=UZYKLXISGJDWHX-UHFFFAOYSA-N
SMILES:O=C1C=2C3=C4C(C(=O)N(CCCCCC)C(=O)C4=CC=C3C(=O)N1CCCCCC)=C(Br)C2
Synonyms:
  • 4-Bromo-2,7-dihexylbenzo[lmn][3,8]phenanthroline-1,3,6,8(2H,7H)-tetrone
  • Benzo[lmn][3,8]phenanthroline-1,3,6,8(2H,7H)-tetrone, 4-bromo-2,7-dihexyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.