
CAS 1315610-08-2
:Piperidine, 3-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]-, hydrochloride (1:1)
Description:
Piperidine, 3-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered saturated heterocyclic ring containing one nitrogen atom. The presence of a trifluoromethyl group and a 1,2,4-oxadiazole moiety contributes to its unique properties, including potential biological activity and increased lipophilicity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceutical contexts. The trifluoromethyl group is known to influence the compound's electronic properties and can enhance its metabolic stability. This compound may exhibit interesting pharmacological activities, making it a subject of interest in medicinal chemistry. Its specific interactions and effects would depend on the context of its use, including the biological targets it may engage with. Safety and handling precautions should be observed, as with any chemical substance, particularly those with potential biological activity.
Formula:C8H10F3N3O·ClH
InChI:InChI=1S/C8H10F3N3O.ClH/c9-8(10,11)7-13-6(14-15-7)5-2-1-3-12-4-5;/h5,12H,1-4H2;1H
InChI key:InChIKey=FBEYDTRBWPVWFJ-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=NC(=NO1)C2CCCNC2.Cl
Synonyms:- Piperidine, 3-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3-[5-(Trifluoromethyl)-1,2,4-oxadiazol-3-yl]piperidine hydrochloride
CAS:Color and Shape:SolidMolecular weight:257.6400146484375
