CAS 1315611-83-6

6-(Difluoromethyl)-5-fluoro-2-pyridinamine

Description:

6-(Difluoromethyl)-5-fluoro-2-pyridinamine is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a difluoromethyl group and a fluorine atom attached to the pyridine, contributing to its unique reactivity and potential applications in medicinal chemistry. The presence of multiple fluorine atoms often enhances the lipophilicity and metabolic stability of the compound, making it of interest in drug design. Its molecular structure suggests potential interactions with biological targets, which may be explored in the context of pharmaceuticals. Additionally, the compound's properties, such as solubility, boiling point, and melting point, are influenced by the electronegative fluorine atoms, which can affect intermolecular interactions. As with many fluorinated compounds, it may exhibit distinct behavior in biological systems, warranting further investigation into its pharmacokinetics and pharmacodynamics. Overall, 6-(Difluoromethyl)-5-fluoro-2-pyridinamine represents a class of compounds that are valuable in the development of new therapeutic agents.

Formula: C₆H₅F₃N₂

InChI: InChI=1S/C6H5F3N2/c7-3-1-2-4(10)11-5(3)6(8)9/h1-2,6H,(H2,10,11)

InChI key: InChIKey=MILXNEJKBSDOTA-UHFFFAOYSA-N

SMILES: C(F)(F)C1=C(F)C=CC(N)=N1

Synonyms:

• 2-Pyridinamine, 6-(difluoromethyl)-5-fluoro-
• 6-(Difluoromethyl)-5-fluoro-2-pyridinamine