CymitQuimica logo

CAS 1315619-16-9

:

5-Chloro-2-(1H-pyrrol-1-yl)-4-(trifluoromethyl)benzenamine

Description:
5-Chloro-2-(1H-pyrrol-1-yl)-4-(trifluoromethyl)benzenamine is an organic compound characterized by its complex structure, which includes a chloro substituent, a pyrrole ring, and a trifluoromethyl group attached to a benzene ring. The presence of the chloro group indicates that it is a chlorinated aromatic compound, which can influence its reactivity and solubility. The trifluoromethyl group is known for imparting unique electronic properties, enhancing lipophilicity, and potentially increasing biological activity. The pyrrole moiety contributes to the compound's aromaticity and can participate in various chemical reactions, including electrophilic substitutions. This compound may exhibit interesting pharmacological properties, making it of interest in medicinal chemistry. Its molecular interactions, stability, and reactivity can be influenced by the arrangement of functional groups and the overall electronic distribution within the molecule. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C11H8ClF3N2
InChI:InChI=1S/C11H8ClF3N2/c12-8-6-9(16)10(17-3-1-2-4-17)5-7(8)11(13,14)15/h1-6H,16H2
InChI key:InChIKey=HWKWADYVFZUQOR-UHFFFAOYSA-N
SMILES:NC=1C(=CC(C(F)(F)F)=C(Cl)C1)N2C=CC=C2
Synonyms:
  • 5-Chloro-2-(1H-pyrrol-1-yl)-4-(trifluoromethyl)benzenamine
  • Benzenamine, 5-chloro-2-(1H-pyrrol-1-yl)-4-(trifluoromethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.