CAS 131565-87-2
:cis-3,4-Dihydroxypyrrolidine
Description:
Cis-3,4-Dihydroxypyrrolidine is a cyclic organic compound characterized by a five-membered ring structure containing nitrogen and hydroxyl functional groups. The "cis" designation indicates that the hydroxyl groups are positioned on the same side of the ring, which influences the compound's stereochemistry and reactivity. This substance is a derivative of pyrrolidine, a saturated nitrogen-containing heterocycle, and its hydroxyl groups contribute to its hydrophilicity, making it soluble in polar solvents. The presence of these functional groups also suggests potential for hydrogen bonding, which can affect its interactions with other molecules. Cis-3,4-Dihydroxypyrrolidine may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that can influence biological activity. Additionally, its unique configuration may play a role in enzyme interactions or as a chiral building block in organic synthesis. Overall, the compound's characteristics make it of interest in various fields, including organic chemistry and drug design.
Formula:C4H9NO2
InChI:InChI=1/C4H9NO2/c6-3-1-5-2-4(3)7/h3-7H,1-2H2/t3-,4+
Synonyms:- (3R,4S)-pyrrolidine-3,4-diol
- cis-3,4-Dihydroxypyrrolidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
