CAS 131574-34-0
:2,4-difluoro-5-nitrobenzene sulfonic acid
Description:
2,4-Difluoro-5-nitrobenzene sulfonic acid is an aromatic sulfonic acid characterized by the presence of both fluorine and nitro substituents on the benzene ring. The compound features two fluorine atoms located at the 2 and 4 positions, and a nitro group at the 5 position, along with a sulfonic acid group (-SO3H) that is typically found at the para position relative to the nitro group. This structure imparts significant polarity and solubility in polar solvents, making it useful in various chemical applications. The presence of the sulfonic acid group enhances its acidity, allowing it to participate in acid-base reactions. Additionally, the fluorine atoms contribute to the compound's stability and reactivity, influencing its behavior in electrophilic aromatic substitution reactions. Due to its unique functional groups, 2,4-difluoro-5-nitrobenzene sulfonic acid can serve as an important intermediate in the synthesis of dyes, pharmaceuticals, and agrochemicals. Safety precautions should be observed when handling this compound, as it may pose health risks due to its acidic nature and potential toxicity.
Formula:C6H3F2NO5S
InChI:InChI=1/C6H3F2NO5S/c7-3-1-4(8)6(15(12,13)14)2-5(3)9(10)11/h1-2H,(H,12,13,14)
SMILES:c1c(c(cc(c1F)S(=O)(=O)O)N(=O)=O)F
Synonyms:- 2,4-Difluoro-5-nitrobenzenesulfonic acid
- 2,4-Dnsa
- Benzenesulfonic acid, 2,4-difluoro-5-nitro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
