CymitQuimica logo

CAS 131598-62-4

:

6-Amino-5-(ethylamino)-1-methyl-2,4(1H,3H)-pyrimidinedione

Description:
6-Amino-5-(ethylamino)-1-methyl-2,4(1H,3H)-pyrimidinedione, with the CAS number 131598-62-4, is a chemical compound that belongs to the pyrimidine family, characterized by a pyrimidinedione structure. This compound features an amino group at the 6-position, an ethylamino substituent at the 5-position, and a methyl group at the 1-position of the pyrimidine ring. The presence of these functional groups contributes to its potential biological activity, making it of interest in pharmaceutical research. The compound is typically a solid at room temperature and may exhibit solubility in polar solvents due to the presence of amino groups. Its molecular structure suggests it may participate in hydrogen bonding, influencing its reactivity and interactions with biological targets. Additionally, the compound's properties, such as melting point, boiling point, and spectral characteristics, would be essential for understanding its behavior in various chemical environments and applications in medicinal chemistry.
Formula:C7H12N4O2
InChI:InChI=1S/C7H12N4O2/c1-3-9-4-5(8)11(2)7(13)10-6(4)12/h9H,3,8H2,1-2H3,(H,10,12,13)
InChI key:InChIKey=CQTYPMGBSFAJIN-UHFFFAOYSA-N
SMILES:N(CC)C1=C(N)N(C)C(=O)NC1=O
Synonyms:
  • 6-Amino-5-(ethylamino)-1-methyl-2,4(1H,3H)-pyrimidinedione
  • 2,4(1H,3H)-Pyrimidinedione, 6-amino-5-(ethylamino)-1-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.