CAS 13160-06-0
:N-(3-Pyridyl)nicotinamide
Description:
N-(3-Pyridyl)nicotinamide, with the CAS number 13160-06-0, is a chemical compound that belongs to the class of nicotinamide derivatives. It features a pyridine ring substituted at the 3-position with a nicotinamide moiety, which is a form of vitamin B3. This compound is characterized by its aromatic structure, which contributes to its potential biological activity. N-(3-Pyridyl)nicotinamide is known for its role in various biochemical processes, particularly in cellular metabolism and as a precursor to important coenzymes. It exhibits solubility in polar solvents, making it suitable for various applications in biochemical research and pharmaceutical formulations. The compound may also possess antioxidant properties and has been studied for its potential therapeutic effects in various conditions, including neurodegenerative diseases. As with many nicotinamide derivatives, it may interact with biological systems through mechanisms involving enzyme modulation or receptor binding, highlighting its significance in medicinal chemistry.
Formula:C11H9N3O
InChI:InChI=1S/C11H9N3O/c15-11(9-3-1-5-12-7-9)14-10-4-2-6-13-8-10/h1-8H,(H,14,15)
InChI key:InChIKey=HMCAHAHCCWFPOF-UHFFFAOYSA-N
SMILES:C(NC=1C=CC=NC1)(=O)C=2C=CC=NC2
Synonyms:- N-(3-Pyridyl)nicotinamide
- 3-Pyridinecarboxamide, N-3-pyridinyl-
- Nicotinamide, N-3-pyridyl-
- N-3-Pyridinyl-3-pyridinecarboxamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
