CAS 13160-07-1
:N-2-Pyridinyl-3-pyridinecarboxamide
Description:
N-2-Pyridinyl-3-pyridinecarboxamide, also known by its CAS number 13160-07-1, is a chemical compound characterized by its pyridine ring structures, which contribute to its aromatic properties and potential biological activity. This compound features a carboxamide functional group, which enhances its solubility in polar solvents and may influence its interaction with biological targets. The presence of multiple nitrogen atoms in the pyridine rings can facilitate hydrogen bonding and coordination with metal ions, making it of interest in coordination chemistry and medicinal applications. Its structural configuration suggests potential uses in pharmaceuticals, particularly in the development of compounds with antimicrobial or anti-inflammatory properties. Additionally, the compound's stability and reactivity can be influenced by the electronic effects of the nitrogen atoms and the overall molecular geometry. As with many heterocyclic compounds, its synthesis and characterization are crucial for understanding its properties and potential applications in various fields, including drug design and agrochemicals.
Formula:C11H9N3O
InChI:InChI=1S/C11H9N3O/c15-11(9-4-3-6-12-8-9)14-10-5-1-2-7-13-10/h1-8H,(H,13,14,15)
InChI key:InChIKey=QZNPXKRALPFXPR-UHFFFAOYSA-N
SMILES:C(NC1=CC=CC=N1)(=O)C=2C=CC=NC2
Synonyms:- 3-Pyridinecarboxamide, N-2-pyridinyl-
- N-(2-Pyridinyl)-3-pyridinecarboxamide
- N-(pyridin-2-yl)pyridine-3-carboxamide
- N-2-Pyridylnicotinamide
- Nicotinamide, N-2-pyridyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Nicotinamide, N-(2-pyridyl)-
CAS:Nicotinamide, N-(2-pyridyl)- is a biochemical.Formula:C11H9N3OColor and Shape:SolidMolecular weight:199.21

