CAS 131607-93-7
:(2-oxo-2,3,4,5-tetrahydro-1H-1-benzazepin-1-yl)acetic acid
Description:
(2-oxo-2,3,4,5-tetrahydro-1H-1-benzazepin-1-yl)acetic acid, with the CAS number 131607-93-7, is a chemical compound that features a benzazepine core structure, which is a bicyclic compound containing both a benzene ring and a seven-membered nitrogen-containing ring. This compound is characterized by the presence of a ketone functional group (2-oxo) and an acetic acid moiety, which contributes to its acidic properties. The tetrahydro configuration indicates that the compound has a saturated ring system, enhancing its stability and potentially influencing its biological activity. The presence of the nitrogen atom in the benzazepine structure may also impart unique pharmacological properties, making it of interest in medicinal chemistry. Overall, this compound's structural features suggest potential applications in drug development, particularly in areas targeting neurological or psychiatric conditions, although specific biological activities would require further investigation.
Formula:C12H13NO3
InChI:InChI=1/C12H13NO3/c14-11-7-3-5-9-4-1-2-6-10(9)13(11)8-12(15)16/h1-2,4,6H,3,5,7-8H2,(H,15,16)
SMILES:c1ccc2c(c1)CCCC(=O)N2CC(=O)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.