CAS 13161-75-6
:Pteryxin
Description:
Pteryxin, with the CAS number 13161-75-6, is a chemical compound that belongs to the class of flavonoids, which are known for their diverse biological activities and potential health benefits. It is primarily derived from certain plant sources and is recognized for its antioxidant properties, which can help neutralize free radicals in biological systems. Pteryxin may also exhibit anti-inflammatory effects and has been studied for its potential role in various therapeutic applications, including cardiovascular health and neuroprotection. The compound's structure typically features a flavone backbone, which is characteristic of many flavonoids, contributing to its reactivity and interaction with biological molecules. Additionally, pteryxin's solubility and stability can vary depending on the solvent and environmental conditions, influencing its bioavailability and efficacy in biological systems. As research continues, the full range of its pharmacological effects and mechanisms of action is being explored, highlighting its significance in both natural product chemistry and potential medicinal applications.
Formula:C21H22O7
InChI:InChI=1S/C21H22O7/c1-6-11(2)20(24)27-18-16-14(28-21(4,5)19(18)25-12(3)22)9-7-13-8-10-15(23)26-17(13)16/h6-10,18-19H,1-5H3/b11-6-/t18-,19-/m1/s1
InChI key:InChIKey=LYUZYPKZQDYMEE-YRCPKEQFSA-N
SMILES:O(C(/C(=C\C)/C)=O)[C@@H]1C=2C3=C(C=CC2OC(C)(C)[C@@H]1OC(C)=O)C=CC(=O)O3
Synonyms:- (+)-(3′R,4′R)-3′-Acetyl-4′-angeloylkhellactone
- (9R,10R)-9-(acetyloxy)-8,8-dimethyl-2-oxo-9,10-dihydro-2H,8H-pyrano[2,3-f]chromen-10-yl (2E)-2-methylbut-2-enoate
- (9R,10R)-9-(acetyloxy)-8,8-dimethyl-2-oxo-9,10-dihydro-2H,8H-pyrano[2,3-f]chromen-10-yl (2Z)-2-methylbut-2-enoate
- 2-Butenoic acid, 2-methyl-, (9R,10R)-9-(acetyloxy)-9,10-dihydro-8,8-dimethyl-2-oxo-2H,8H-benzo[1,2-b:3,4-b′]dipyran-10-yl ester, (2Z)-
- 2-Butenoic acid, 2-methyl-, 9-(acetyloxy)-9,10-dihydro-8,8-dimethyl-2-oxo-2H,8H-benzo(1,2-b:3,4-b')dipyran-10-yl ester, (9R-(9alpha,10alpha(Z)))-
- 2-Butenoic acid, 2-methyl-, 9-(acetyloxy)-9,10-dihydro-8,8-dimethyl-2-oxo-2H,8H-benzo[1,2-b:3,4-b′]dipyran-10-yl ester, [9R-[9α,10α(Z)]]-
- 2H,8H-Benzo[1,2-b:3,4-b′]dipyran, 2-butenoic acid deriv.
- Crotonic acid, 2-methyl-, 10-ester with 9,10-dihydro-9,10-dihydroxy-8,8-dimethyl-2H,8H-benzo[1,2-b:3,4-b′]dipyran-2-one acetate, (Z)-
- Pterixin
- Pteryxine
- cis-3′-Acetyl-4′-angeloylkhellactone
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Pteryxin
CAS:(+)-Pteryxin ((+)-Pteryxin) has muscle-relaxant props. (+)-Pteryxin shows hepatoprotective and nitric oxide prodn. inhibitory activity.Formula:C21H22O7Purity:98.94% - 99.92%Color and Shape:SolidMolecular weight:386.40Pteryxin
CAS:Pteryxin is an alkaloid derivative, which is a natural product isolated primarily from certain plant species within the Apiaceae family. As a complex organic compound, it exhibits a range of biochemical interactions at the molecular level. The mode of action for Pteryxin primarily involves its ability to interact with specific enzymatic pathways and receptors, facilitating or inhibiting particular physiological processes. This biochemical interaction underlies its potential pharmacological effects, which are these products' primary focus of study.
Formula:C21H22O7Purity:Min. 95%Color and Shape:PowderMolecular weight:386.4 g/mol





